C20H15Cl2F3O3S — CID 71042696
methyl 3-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate (PubChem CID 71042696) has the molecular formula C20H15Cl2F3O3S and a molecular weight of 463.30 g/mol. Its IUPAC name is methyl 3-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate.
| Compound Name | methyl 3-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate |
|---|---|
| PubChem CID | 71042696 |
| Molecular Formula | C20H15Cl2F3O3S |
| Molecular Weight | 463.30 g/mol |
| Exact Mass | 462.01 |
| IUPAC Name | methyl 3-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-4,5,6,7-tetrahydro-2-benzothiophene-1-carboxylate |
| SMILES | COC(=O)c1sc(C(=O)/C=C(\c2cc(Cl)cc(Cl)c2)C(F)(F)F)c2c1CCCC2 |
| InChI | InChI=1S/C20H15Cl2F3O3S/c1-28-19(27)18-14-5-3-2-4-13(14)17(29-18)16(26)9-15(20(23,24)25)10-6-11(21)8-12(22)7-10/h6-9H,2-5H2,1H3/b15-9+ |
| InChIKey | PADRARULFWBPOP-OQLLNIDSSA-N |
| XLogP | 6.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.30 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|