C17H10Cl2F3NO3 — CID 68519479
(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methyl-3-nitrophenyl)but-2-en-1-one (PubChem CID 68519479) has the molecular formula C17H10Cl2F3NO3 and a molecular weight of 404.17 g/mol. Its IUPAC name is (E)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methyl-3-nitrophenyl)but-2-en-1-one.
| Compound Name | (E)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methyl-3-nitrophenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 68519479 |
| Molecular Formula | C17H10Cl2F3NO3 |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 403.00 |
| IUPAC Name | (E)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methyl-3-nitrophenyl)but-2-en-1-one |
| SMILES | Cc1ccc(C(=O)/C=C(\c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H10Cl2F3NO3/c1-9-2-3-10(6-15(9)23(25)26)16(24)8-14(17(20,21)22)11-4-12(18)7-13(19)5-11/h2-8H,1H3/b14-8+ |
| InChIKey | DMYFOBACSYWLHQ-RIYZIHGNSA-N |
| XLogP | 6.04 |
| TPSA | 60.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|