C17H11Cl2F3O — CID 68519172
3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one (PubChem CID 68519172) has the molecular formula C17H11Cl2F3O and a molecular weight of 359.17 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one.
| Compound Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one |
|---|---|
| PubChem CID | 68519172 |
| Molecular Formula | C17H11Cl2F3O |
| Molecular Weight | 359.17 g/mol |
| Exact Mass | 358.01 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(4-methylphenyl)but-2-en-1-one |
| SMILES | Cc1ccc(C(=O)C=C(c2cc(Cl)cc(Cl)c2)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H11Cl2F3O/c1-10-2-4-11(5-3-10)16(23)9-15(17(20,21)22)12-6-13(18)8-14(19)7-12/h2-9H,1H3 |
| InChIKey | FYNLTDYIIKCDNZ-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.17 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|