C20H14Cl2F3NO4 — CID 167454649
2-[[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoyl]amino]acetic acid (PubChem CID 167454649) has the molecular formula C20H14Cl2F3NO4 and a molecular weight of 460.24 g/mol. Its IUPAC name is 2-[[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoyl]amino]acetic acid.
| Compound Name | 2-[[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoyl]amino]acetic acid |
|---|---|
| PubChem CID | 167454649 |
| Molecular Formula | C20H14Cl2F3NO4 |
| Molecular Weight | 460.24 g/mol |
| Exact Mass | 459.03 |
| IUPAC Name | 2-[[4-[(E)-3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoyl]amino]acetic acid |
| SMILES | Cc1cc(C(=O)/C=C(\c2cc(Cl)cc(Cl)c2)C(F)(F)F)ccc1C(=O)NCC(=O)O |
| InChI | InChI=1S/C20H14Cl2F3NO4/c1-10-4-11(2-3-15(10)19(30)26-9-18(28)29)17(27)8-16(20(23,24)25)12-5-13(21)7-14(22)6-12/h2-8H,9H2,1H3,(H,26,30)(H,28,29)/b16-8+ |
| InChIKey | HULDXTUKPGIUDX-LZYBPNLTSA-N |
| XLogP | 4.94 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.24 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|