C23H18Cl2F4N2O4 — CID 130288763
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide (PubChem CID 130288763) has the molecular formula C23H18Cl2F4N2O4 and a molecular weight of 533.31 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 130288763 |
| Molecular Formula | C23H18Cl2F4N2O4 |
| Molecular Weight | 533.31 g/mol |
| Exact Mass | 532.06 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide |
| SMILES | CCN1OC[C@@H](NC(=O)c2ccc(C(=O)/C=C(\c3cc(Cl)c(F)c(Cl)c3)C(F)(F)F)cc2C)C1=O |
| InChI | InChI=1S/C23H18Cl2F4N2O4/c1-3-31-22(34)18(10-35-31)30-21(33)14-5-4-12(6-11(14)2)19(32)9-15(23(27,28)29)13-7-16(24)20(26)17(25)8-13/h4-9,18H,3,10H2,1-2H3,(H,30,33)/b15-9+/t18-/m1/s1 |
| InChIKey | ZPQWQEWQLQWIIF-IKFRKZOMSA-N |
| XLogP | 5.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.31 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|