C23H20Cl2F4N4O4 — CID 142606843
4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(2-ethyl-3-oxo-1,2-oxazolidin-4-yl)-2-methylbenzohydrazide (PubChem CID 142606843) has the molecular formula C23H20Cl2F4N4O4 and a molecular weight of 563.34 g/mol. Its IUPAC name is 4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(2-ethyl-3-oxo-1,2-oxazolidin-4-yl)-2-methylbenzohydrazide.
| Compound Name | 4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(2-ethyl-3-oxo-1,2-oxazolidin-4-yl)-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 142606843 |
| Molecular Formula | C23H20Cl2F4N4O4 |
| Molecular Weight | 563.34 g/mol |
| Exact Mass | 562.08 |
| IUPAC Name | 4-[(5R)-5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(2-ethyl-3-oxo-1,2-oxazolidin-4-yl)-2-methylbenzohydrazide |
| SMILES | CCN1OCC(NNC(=O)c2ccc(C3=NO[C@](c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc2C)C1=O |
| InChI | InChI=1S/C23H20Cl2F4N4O4/c1-3-33-21(35)18(10-36-33)30-31-20(34)14-5-4-12(6-11(14)2)17-9-22(37-32-17,23(27,28)29)13-7-15(24)19(26)16(25)8-13/h4-8,18,30H,3,9-10H2,1-2H3,(H,31,34)/t18?,22-/m1/s1 |
| InChIKey | BEMYHNKFUWAXQJ-LMNIDFBRSA-N |
| XLogP | 4.42 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.34 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|