C20H14Cl3F3N2O4 — CID 86654471
methyl N-[2-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoyl]carbamate (PubChem CID 86654471) has the molecular formula C20H14Cl3F3N2O4 and a molecular weight of 509.70 g/mol. Its IUPAC name is methyl N-[2-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoyl]carbamate.
| Compound Name | methyl N-[2-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoyl]carbamate |
|---|---|
| PubChem CID | 86654471 |
| Molecular Formula | C20H14Cl3F3N2O4 |
| Molecular Weight | 509.70 g/mol |
| Exact Mass | 508.00 |
| IUPAC Name | methyl N-[2-methyl-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzoyl]carbamate |
| SMILES | COC(=O)NC(=O)c1ccc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C20H14Cl3F3N2O4/c1-9-5-10(3-4-12(9)17(29)27-18(30)31-2)15-8-19(32-28-15,20(24,25)26)11-6-13(21)16(23)14(22)7-11/h3-7H,8H2,1-2H3,(H,27,29,30) |
| InChIKey | YXDNFLRVCGAOME-UHFFFAOYSA-N |
| XLogP | 6.03 |
| TPSA | 76.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.70 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|