C26H20Cl2F3N3O4 — CID 163288341
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(3-methoxybenzoyl)-2-methylbenzohydrazide (PubChem CID 163288341) has the molecular formula C26H20Cl2F3N3O4 and a molecular weight of 566.36 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(3-methoxybenzoyl)-2-methylbenzohydrazide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(3-methoxybenzoyl)-2-methylbenzohydrazide |
|---|---|
| PubChem CID | 163288341 |
| Molecular Formula | C26H20Cl2F3N3O4 |
| Molecular Weight | 566.36 g/mol |
| Exact Mass | 565.08 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N'-(3-methoxybenzoyl)-2-methylbenzohydrazide |
| SMILES | COc1cccc(C(=O)NNC(=O)c2ccc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)cc2C)c1 |
| InChI | InChI=1S/C26H20Cl2F3N3O4/c1-14-8-15(6-7-21(14)24(36)33-32-23(35)16-4-3-5-20(9-16)37-2)22-13-25(38-34-22,26(29,30)31)17-10-18(27)12-19(28)11-17/h3-12H,13H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | RJLCVDJYQVJCHP-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.36 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|