C20H15Cl2F3N2O4 — CID 173073852
methyl 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-hydroxyiminoacetate (PubChem CID 173073852) has the molecular formula C20H15Cl2F3N2O4 and a molecular weight of 475.25 g/mol. Its IUPAC name is methyl 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-hydroxyiminoacetate.
| Compound Name | methyl 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-hydroxyiminoacetate |
|---|---|
| PubChem CID | 173073852 |
| Molecular Formula | C20H15Cl2F3N2O4 |
| Molecular Weight | 475.25 g/mol |
| Exact Mass | 474.04 |
| IUPAC Name | methyl 2-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-hydroxyiminoacetate |
| SMILES | COC(=O)C(=NO)c1ccc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)cc1C |
| InChI | InChI=1S/C20H15Cl2F3N2O4/c1-10-5-11(3-4-15(10)17(26-29)18(28)30-2)16-9-19(31-27-16,20(23,24)25)12-6-13(21)8-14(22)7-12/h3-8,29H,9H2,1-2H3 |
| InChIKey | NKLTWOMXKFGXOD-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.25 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|