C21H16Cl2F6N2O3 — CID 25217023
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(2,2,2-trifluoroethoxymethyl)benzamide (PubChem CID 25217023) has the molecular formula C21H16Cl2F6N2O3 and a molecular weight of 529.26 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(2,2,2-trifluoroethoxymethyl)benzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(2,2,2-trifluoroethoxymethyl)benzamide |
|---|---|
| PubChem CID | 25217023 |
| Molecular Formula | C21H16Cl2F6N2O3 |
| Molecular Weight | 529.26 g/mol |
| Exact Mass | 528.04 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(2,2,2-trifluoroethoxymethyl)benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NCOCC(F)(F)F |
| InChI | InChI=1S/C21H16Cl2F6N2O3/c1-11-4-12(2-3-16(11)18(32)30-10-33-9-20(24,25)26)17-8-19(34-31-17,21(27,28)29)13-5-14(22)7-15(23)6-13/h2-7H,8-10H2,1H3,(H,30,32) |
| InChIKey | UWQZMKRYYLYXSA-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 59.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.26 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|