C18H15ClF3N3O2 — CID 178099924
4-[5-(3-amino-5-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide (PubChem CID 178099924) has the molecular formula C18H15ClF3N3O2 and a molecular weight of 397.78 g/mol. Its IUPAC name is 4-[5-(3-amino-5-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide.
| Compound Name | 4-[5-(3-amino-5-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 178099924 |
| Molecular Formula | C18H15ClF3N3O2 |
| Molecular Weight | 397.78 g/mol |
| Exact Mass | 397.08 |
| IUPAC Name | 4-[5-(3-amino-5-chlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(N)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(N)=O |
| InChI | InChI=1S/C18H15ClF3N3O2/c1-9-4-10(2-3-14(9)16(24)26)15-8-17(27-25-15,18(20,21)22)11-5-12(19)7-13(23)6-11/h2-7H,8,23H2,1H3,(H2,24,26) |
| InChIKey | KORCVUKFMQYKCS-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 90.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.78 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|