C21H17Cl2F3N2O4S — CID 134588412
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-dihydroxythietan-3-yl)-2-methylbenzamide (PubChem CID 134588412) has the molecular formula C21H17Cl2F3N2O4S and a molecular weight of 521.34 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-dihydroxythietan-3-yl)-2-methylbenzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-dihydroxythietan-3-yl)-2-methylbenzamide |
|---|---|
| PubChem CID | 134588412 |
| Molecular Formula | C21H17Cl2F3N2O4S |
| Molecular Weight | 521.34 g/mol |
| Exact Mass | 520.02 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-(2,2-dihydroxythietan-3-yl)-2-methylbenzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC1CSC1(O)O |
| InChI | InChI=1S/C21H17Cl2F3N2O4S/c1-10-4-11(2-3-15(10)18(29)27-17-9-33-20(17,30)31)16-8-19(32-28-16,21(24,25)26)12-5-13(22)7-14(23)6-12/h2-7,17,30-31H,8-9H2,1H3,(H,27,29) |
| InChIKey | CDRGXKWXBUSJIC-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 91.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.34 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|