C21H16BrCl2F3N2O2S — CID 118219264
4-[5-(4-bromo-3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide (PubChem CID 118219264) has the molecular formula C21H16BrCl2F3N2O2S and a molecular weight of 568.24 g/mol. Its IUPAC name is 4-[5-(4-bromo-3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide.
| Compound Name | 4-[5-(4-bromo-3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide |
|---|---|
| PubChem CID | 118219264 |
| Molecular Formula | C21H16BrCl2F3N2O2S |
| Molecular Weight | 568.24 g/mol |
| Exact Mass | 565.94 |
| IUPAC Name | 4-[5-(4-bromo-3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-(thietan-3-yl)benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)c(Br)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC1CSC1 |
| InChI | InChI=1S/C21H16BrCl2F3N2O2S/c1-10-4-11(2-3-14(10)19(30)28-13-8-32-9-13)17-7-20(31-29-17,21(25,26)27)12-5-15(23)18(22)16(24)6-12/h2-6,13H,7-9H2,1H3,(H,28,30) |
| InChIKey | DWRLPMVWPHYNFS-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.24 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|