C22H18Cl3F3N2O2S — CID 89419815
2-methyl-N-(3-methylthietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide (PubChem CID 89419815) has the molecular formula C22H18Cl3F3N2O2S and a molecular weight of 537.82 g/mol. Its IUPAC name is 2-methyl-N-(3-methylthietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide.
| Compound Name | 2-methyl-N-(3-methylthietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
|---|---|
| PubChem CID | 89419815 |
| Molecular Formula | C22H18Cl3F3N2O2S |
| Molecular Weight | 537.82 g/mol |
| Exact Mass | 536.01 |
| IUPAC Name | 2-methyl-N-(3-methylthietan-3-yl)-4-[5-(3,4,5-trichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NC1(C)CSC1 |
| InChI | InChI=1S/C22H18Cl3F3N2O2S/c1-11-5-12(3-4-14(11)19(31)29-20(2)9-33-10-20)17-8-21(32-30-17,22(26,27)28)13-6-15(23)18(25)16(24)7-13/h3-7H,8-10H2,1-2H3,(H,29,31) |
| InChIKey | QMWHVJMLKPIEAQ-UHFFFAOYSA-N |
| XLogP | 6.77 |
| TPSA | 50.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.82 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|