C25H16Cl2F4IN3O3 — CID 163288354
N'-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-2-fluoro-6-iodobenzohydrazide (PubChem CID 163288354) has the molecular formula C25H16Cl2F4IN3O3 and a molecular weight of 680.22 g/mol. Its IUPAC name is N'-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-2-fluoro-6-iodobenzohydrazide.
| Compound Name | N'-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-2-fluoro-6-iodobenzohydrazide |
|---|---|
| PubChem CID | 163288354 |
| Molecular Formula | C25H16Cl2F4IN3O3 |
| Molecular Weight | 680.22 g/mol |
| Exact Mass | 678.95 |
| IUPAC Name | N'-[4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylbenzoyl]-2-fluoro-6-iodobenzohydrazide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)NNC(=O)c1c(F)cccc1I |
| InChI | InChI=1S/C25H16Cl2F4IN3O3/c1-12-7-13(5-6-17(12)22(36)33-34-23(37)21-18(28)3-2-4-19(21)32)20-11-24(38-35-20,25(29,30)31)14-8-15(26)10-16(27)9-14/h2-10H,11H2,1H3,(H,33,36)(H,34,37) |
| InChIKey | FYEWOSARBGBQBG-UHFFFAOYSA-N |
| XLogP | 6.70 |
| TPSA | 79.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.22 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|