C25H20Cl2F4N2O4 — CID 159694778
(3R)-3-[2-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-oxoethyl]-1-ethylpyrrolidine-2,5-dione (PubChem CID 159694778) has the molecular formula C25H20Cl2F4N2O4 and a molecular weight of 559.34 g/mol. Its IUPAC name is (3R)-3-[2-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-oxoethyl]-1-ethylpyrrolidine-2,5-dione.
| Compound Name | (3R)-3-[2-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-oxoethyl]-1-ethylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 159694778 |
| Molecular Formula | C25H20Cl2F4N2O4 |
| Molecular Weight | 559.34 g/mol |
| Exact Mass | 558.07 |
| IUPAC Name | (3R)-3-[2-[4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methylphenyl]-2-oxoethyl]-1-ethylpyrrolidine-2,5-dione |
| SMILES | CCN1C(=O)C[C@@H](CC(=O)c2ccc(C3=NOC(c4cc(Cl)c(F)c(Cl)c4)(C(F)(F)F)C3)cc2C)C1=O |
| InChI | InChI=1S/C25H20Cl2F4N2O4/c1-3-33-21(35)8-14(23(33)36)7-20(34)16-5-4-13(6-12(16)2)19-11-24(37-32-19,25(29,30)31)15-9-17(26)22(28)18(27)10-15/h4-6,9-10,14H,3,7-8,11H2,1-2H3/t14-,24?/m1/s1 |
| InChIKey | MWWGEBXVEZIRMI-GMBBYQRISA-N |
| XLogP | 5.99 |
| TPSA | 76.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.34 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|