C23H13Cl2F10N5O2 — CID 163397925
4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]benzamide (PubChem CID 163397925) has the molecular formula C23H13Cl2F10N5O2 and a molecular weight of 652.28 g/mol. Its IUPAC name is 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 163397925 |
| Molecular Formula | C23H13Cl2F10N5O2 |
| Molecular Weight | 652.28 g/mol |
| Exact Mass | 651.03 |
| IUPAC Name | 4-[5-(3,5-dichloro-4-fluorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-(2,2,2-trifluoroethyl)-5-(trifluoromethyl)-1,2,4-triazol-3-yl]benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)c(F)c(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)Nc1nc(C(F)(F)F)n(CC(F)(F)F)n1 |
| InChI | InChI=1S/C23H13Cl2F10N5O2/c1-9-4-10(15-7-20(42-39-15,23(33,34)35)11-5-13(24)16(26)14(25)6-11)2-3-12(9)17(41)36-19-37-18(22(30,31)32)40(38-19)8-21(27,28)29/h2-6H,7-8H2,1H3,(H,36,38,41) |
| InChIKey | RAVYCLKLHHZQGE-UHFFFAOYSA-N |
| XLogP | 7.45 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 652.28 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|