C24H19Cl2F6N5O2 — CID 163397955
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-methyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]benzamide (PubChem CID 163397955) has the molecular formula C24H19Cl2F6N5O2 and a molecular weight of 594.34 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-methyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]benzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-methyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]benzamide |
|---|---|
| PubChem CID | 163397955 |
| Molecular Formula | C24H19Cl2F6N5O2 |
| Molecular Weight | 594.34 g/mol |
| Exact Mass | 593.08 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-2-methyl-N-[1-methyl-5-(3,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]benzamide |
| SMILES | Cc1cc(C2=NOC(c3cc(Cl)cc(Cl)c3)(C(F)(F)F)C2)ccc1C(=O)Nc1nc(CCC(F)(F)F)n(C)n1 |
| InChI | InChI=1S/C24H19Cl2F6N5O2/c1-12-7-13(18-11-22(39-36-18,24(30,31)32)14-8-15(25)10-16(26)9-14)3-4-17(12)20(38)34-21-33-19(37(2)35-21)5-6-23(27,28)29/h3-4,7-10H,5-6,11H2,1-2H3,(H,34,35,38) |
| InChIKey | NRKZNXAKGKBSSY-UHFFFAOYSA-N |
| XLogP | 6.76 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.34 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |