C25H21Cl2F6N5O2 — CID 175476599
4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[1-ethyl-5-(2,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-2-methylbenzamide (PubChem CID 175476599) has the molecular formula C25H21Cl2F6N5O2 and a molecular weight of 608.37 g/mol. Its IUPAC name is 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[1-ethyl-5-(2,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-2-methylbenzamide.
| Compound Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[1-ethyl-5-(2,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 175476599 |
| Molecular Formula | C25H21Cl2F6N5O2 |
| Molecular Weight | 608.37 g/mol |
| Exact Mass | 607.10 |
| IUPAC Name | 4-[5-(3,5-dichlorophenyl)-5-(trifluoromethyl)-4H-1,2-oxazol-3-yl]-N-[1-ethyl-5-(2,3,3-trifluoropropyl)-1,2,4-triazol-3-yl]-2-methylbenzamide |
| SMILES | CCn1nc(NC(=O)c2ccc(C3=NOC(c4cc(Cl)cc(Cl)c4)(C(F)(F)F)C3)cc2C)nc1CC(F)C(F)F |
| InChI | InChI=1S/C25H21Cl2F6N5O2/c1-3-38-20(10-18(28)21(29)30)34-23(36-38)35-22(39)17-5-4-13(6-12(17)2)19-11-24(40-37-19,25(31,32)33)14-7-15(26)9-16(27)8-14/h4-9,18,21H,3,10-11H2,1-2H3,(H,35,36,39) |
| InChIKey | PNTXZCISJZWZKX-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 81.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.37 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |