C23H21Cl2FN2O4 — CID 130286811
4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)but-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide (PubChem CID 130286811) has the molecular formula C23H21Cl2FN2O4 and a molecular weight of 479.34 g/mol. Its IUPAC name is 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)but-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide.
| Compound Name | 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)but-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide |
|---|---|
| PubChem CID | 130286811 |
| Molecular Formula | C23H21Cl2FN2O4 |
| Molecular Weight | 479.34 g/mol |
| Exact Mass | 478.09 |
| IUPAC Name | 4-[(Z)-3-(3,5-dichloro-4-fluorophenyl)but-2-enoyl]-N-[(4R)-2-ethyl-3-oxo-1,2-oxazolidin-4-yl]-2-methylbenzamide |
| SMILES | CCN1OC[C@@H](NC(=O)c2ccc(C(=O)/C=C(/C)c3cc(Cl)c(F)c(Cl)c3)cc2C)C1=O |
| InChI | InChI=1S/C23H21Cl2FN2O4/c1-4-28-23(31)19(11-32-28)27-22(30)16-6-5-14(7-13(16)3)20(29)8-12(2)15-9-17(24)21(26)18(25)10-15/h5-10,19H,4,11H2,1-3H3,(H,27,30)/b12-8-/t19-/m1/s1 |
| InChIKey | ZAYXLMHSVZBHPA-KEEQEYLASA-N |
| XLogP | 4.62 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.34 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|