C18H10Cl2F4O3 — CID 141356807
4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoic acid (PubChem CID 141356807) has the molecular formula C18H10Cl2F4O3 and a molecular weight of 421.17 g/mol. Its IUPAC name is 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoic acid.
| Compound Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 141356807 |
| Molecular Formula | C18H10Cl2F4O3 |
| Molecular Weight | 421.17 g/mol |
| Exact Mass | 419.99 |
| IUPAC Name | 4-[(E)-3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]-2-methylbenzoic acid |
| SMILES | Cc1cc(C(=O)/C=C(\c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)ccc1C(=O)O |
| InChI | InChI=1S/C18H10Cl2F4O3/c1-8-4-9(2-3-11(8)17(26)27)15(25)7-12(18(22,23)24)10-5-13(19)16(21)14(20)6-10/h2-7H,1H3,(H,26,27)/b12-7+ |
| InChIKey | MCYAFXSKUCMVSQ-KPKJPENVSA-N |
| XLogP | 5.97 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.17 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|