C24H18Cl2F4N2O2 — CID 156770663
N-tert-butyl-5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]isoquinoline-8-carboxamide (PubChem CID 156770663) has the molecular formula C24H18Cl2F4N2O2 and a molecular weight of 513.32 g/mol. Its IUPAC name is N-tert-butyl-5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]isoquinoline-8-carboxamide.
| Compound Name | N-tert-butyl-5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]isoquinoline-8-carboxamide |
|---|---|
| PubChem CID | 156770663 |
| Molecular Formula | C24H18Cl2F4N2O2 |
| Molecular Weight | 513.32 g/mol |
| Exact Mass | 512.07 |
| IUPAC Name | N-tert-butyl-5-[3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluorobut-2-enoyl]isoquinoline-8-carboxamide |
| SMILES | CC(C)(C)NC(=O)c1ccc(C(=O)C=C(c2cc(Cl)c(F)c(Cl)c2)C(F)(F)F)c2ccncc12 |
| InChI | InChI=1S/C24H18Cl2F4N2O2/c1-23(2,3)32-22(34)15-5-4-14(13-6-7-31-11-16(13)15)20(33)10-17(24(28,29)30)12-8-18(25)21(27)19(26)9-12/h4-11H,1-3H3,(H,32,34) |
| InChIKey | MEQGIZPHEVUTJA-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.32 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|