C18H12ClF3N2O3S — CID 155521282
1-[3-chloro-4-(trifluoromethyl)phenyl]-N-methylsulfonylisoquinoline-6-carboxamide (PubChem CID 155521282) has the molecular formula C18H12ClF3N2O3S and a molecular weight of 428.82 g/mol. Its IUPAC name is 1-[3-chloro-4-(trifluoromethyl)phenyl]-N-methylsulfonylisoquinoline-6-carboxamide.
| Compound Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-N-methylsulfonylisoquinoline-6-carboxamide |
|---|---|
| PubChem CID | 155521282 |
| Molecular Formula | C18H12ClF3N2O3S |
| Molecular Weight | 428.82 g/mol |
| Exact Mass | 428.02 |
| IUPAC Name | 1-[3-chloro-4-(trifluoromethyl)phenyl]-N-methylsulfonylisoquinoline-6-carboxamide |
| SMILES | CS(=O)(=O)NC(=O)c1ccc2c(-c3ccc(C(F)(F)F)c(Cl)c3)nccc2c1 |
| InChI | InChI=1S/C18H12ClF3N2O3S/c1-28(26,27)24-17(25)12-2-4-13-10(8-12)6-7-23-16(13)11-3-5-14(15(19)9-11)18(20,21)22/h2-9H,1H3,(H,24,25) |
| InChIKey | CONXPSOEIRZIBT-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 76.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.82 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |