C17H11ClF2N4O — CID 50923586
4-chloro-N-(diaminomethylidene)-1-(2,6-difluorophenyl)isoquinoline-7-carboxamide (PubChem CID 50923586) has the molecular formula C17H11ClF2N4O and a molecular weight of 360.75 g/mol. Its IUPAC name is 4-chloro-N-(diaminomethylidene)-1-(2,6-difluorophenyl)isoquinoline-7-carboxamide.
| Compound Name | 4-chloro-N-(diaminomethylidene)-1-(2,6-difluorophenyl)isoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 50923586 |
| Molecular Formula | C17H11ClF2N4O |
| Molecular Weight | 360.75 g/mol |
| Exact Mass | 360.06 |
| IUPAC Name | 4-chloro-N-(diaminomethylidene)-1-(2,6-difluorophenyl)isoquinoline-7-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(Cl)cnc(-c3c(F)cccc3F)c2c1 |
| InChI | InChI=1S/C17H11ClF2N4O/c18-11-7-23-15(14-12(19)2-1-3-13(14)20)10-6-8(4-5-9(10)11)16(25)24-17(21)22/h1-7H,(H4,21,22,24,25) |
| InChIKey | PONUYLXOKDCITA-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 94.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.75 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|