C16H10ClF2N5O — CID 50923721
1-(3-chloro-5-fluoro-2-pyridinyl)-N-(diaminomethylidene)-4-fluoroisoquinoline-7-carboxamide (PubChem CID 50923721) has the molecular formula C16H10ClF2N5O and a molecular weight of 361.74 g/mol. Its IUPAC name is 1-(3-chloro-5-fluoro-2-pyridinyl)-N-(diaminomethylidene)-4-fluoroisoquinoline-7-carboxamide.
| Compound Name | 1-(3-chloro-5-fluoro-2-pyridinyl)-N-(diaminomethylidene)-4-fluoroisoquinoline-7-carboxamide |
|---|---|
| PubChem CID | 50923721 |
| Molecular Formula | C16H10ClF2N5O |
| Molecular Weight | 361.74 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | 1-(3-chloro-5-fluoro-2-pyridinyl)-N-(diaminomethylidene)-4-fluoroisoquinoline-7-carboxamide |
| SMILES | NC(N)=NC(=O)c1ccc2c(F)cnc(-c3ncc(F)cc3Cl)c2c1 |
| InChI | InChI=1S/C16H10ClF2N5O/c17-11-4-8(18)5-22-14(11)13-10-3-7(15(25)24-16(20)21)1-2-9(10)12(19)6-23-13/h1-6H,(H4,20,21,24,25) |
| InChIKey | SDGMYMHDNSKACE-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 107.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.74 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|