C18H12Cl2F4OS — CID 150740465
3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)but-2-en-1-one (PubChem CID 150740465) has the molecular formula C18H12Cl2F4OS and a molecular weight of 423.26 g/mol. Its IUPAC name is 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)but-2-en-1-one.
| Compound Name | 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 150740465 |
| Molecular Formula | C18H12Cl2F4OS |
| Molecular Weight | 423.26 g/mol |
| Exact Mass | 421.99 |
| IUPAC Name | 3-(3,5-dichloro-4-fluorophenyl)-4,4,4-trifluoro-1-(4,5,6,7-tetrahydro-2-benzothiophen-1-yl)but-2-en-1-one |
| SMILES | O=C(C=C(c1cc(Cl)c(F)c(Cl)c1)C(F)(F)F)c1scc2c1CCCC2 |
| InChI | InChI=1S/C18H12Cl2F4OS/c19-13-5-10(6-14(20)16(13)21)12(18(22,23)24)7-15(25)17-11-4-2-1-3-9(11)8-26-17/h5-8H,1-4H2 |
| InChIKey | JTSVYEVGTSYZOF-UHFFFAOYSA-N |
| XLogP | 6.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.26 |
| LogP ≤ 5 | 6.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|