C19H11Cl2F3OS — CID 71042648
(Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(3-methyl-1-benzothiophen-2-yl)but-2-en-1-one (PubChem CID 71042648) has the molecular formula C19H11Cl2F3OS and a molecular weight of 415.26 g/mol. Its IUPAC name is (Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(3-methyl-1-benzothiophen-2-yl)but-2-en-1-one.
| Compound Name | (Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(3-methyl-1-benzothiophen-2-yl)but-2-en-1-one |
|---|---|
| PubChem CID | 71042648 |
| Molecular Formula | C19H11Cl2F3OS |
| Molecular Weight | 415.26 g/mol |
| Exact Mass | 413.99 |
| IUPAC Name | (Z)-3-(3,5-dichlorophenyl)-4,4,4-trifluoro-1-(3-methyl-1-benzothiophen-2-yl)but-2-en-1-one |
| SMILES | Cc1c(C(=O)/C=C(/c2cc(Cl)cc(Cl)c2)C(F)(F)F)sc2ccccc12 |
| InChI | InChI=1S/C19H11Cl2F3OS/c1-10-14-4-2-3-5-17(14)26-18(10)16(25)9-15(19(22,23)24)11-6-12(20)8-13(21)7-11/h2-9H,1H3/b15-9- |
| InChIKey | QVVMKACRVJXEQL-DHDCSXOGSA-N |
| XLogP | 7.35 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.26 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|