C9H4Cl2F3O2S- — CID 123867022
2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-ene-1-sulfinate (PubChem CID 123867022) has the molecular formula C9H4Cl2F3O2S- and a molecular weight of 304.10 g/mol. Its IUPAC name is 2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-ene-1-sulfinate.
| Compound Name | 2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-ene-1-sulfinate |
|---|---|
| PubChem CID | 123867022 |
| Molecular Formula | C9H4Cl2F3O2S- |
| Molecular Weight | 304.10 g/mol |
| Exact Mass | 302.93 |
| IUPAC Name | 2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-ene-1-sulfinate |
| SMILES | O=S([O-])C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C9H5Cl2F3O2S/c10-6-1-5(2-7(11)3-6)8(4-17(15)16)9(12,13)14/h1-4H,(H,15,16)/p-1 |
| InChIKey | IKHONLTWFCDRAP-UHFFFAOYSA-M |
| XLogP | 3.78 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.10 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|