C20H16Cl2F3NO3 — CID 58338611
ethyl 4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2-methylbenzoate (PubChem CID 58338611) has the molecular formula C20H16Cl2F3NO3 and a molecular weight of 446.25 g/mol. Its IUPAC name is ethyl 4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2-methylbenzoate.
| Compound Name | ethyl 4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2-methylbenzoate |
|---|---|
| PubChem CID | 58338611 |
| Molecular Formula | C20H16Cl2F3NO3 |
| Molecular Weight | 446.25 g/mol |
| Exact Mass | 445.05 |
| IUPAC Name | ethyl 4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]-2-methylbenzoate |
| SMILES | CCOC(=O)c1ccc(C(/C=C(/c2cc(Cl)cc(Cl)c2)C(F)(F)F)=N\O)cc1C |
| InChI | InChI=1S/C20H16Cl2F3NO3/c1-3-29-19(27)16-5-4-12(6-11(16)2)18(26-28)10-17(20(23,24)25)13-7-14(21)9-15(22)8-13/h4-10,28H,3H2,1-2H3/b17-10-,26-18- |
| InChIKey | WKZWYYGWBKGQOJ-SGZNXULJSA-N |
| XLogP | 6.30 |
| TPSA | 58.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.25 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|