C20H17Cl2F3N2O3 — CID 46865636
N-[4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]phenyl]-3-hydroxybutanamide (PubChem CID 46865636) has the molecular formula C20H17Cl2F3N2O3 and a molecular weight of 461.27 g/mol. Its IUPAC name is N-[4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]phenyl]-3-hydroxybutanamide.
| Compound Name | N-[4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]phenyl]-3-hydroxybutanamide |
|---|---|
| PubChem CID | 46865636 |
| Molecular Formula | C20H17Cl2F3N2O3 |
| Molecular Weight | 461.27 g/mol |
| Exact Mass | 460.06 |
| IUPAC Name | N-[4-[(Z)-C-[(Z)-2-(3,5-dichlorophenyl)-3,3,3-trifluoroprop-1-enyl]-N-hydroxycarbonimidoyl]phenyl]-3-hydroxybutanamide |
| SMILES | CC(O)CC(=O)Nc1ccc(C(/C=C(/c2cc(Cl)cc(Cl)c2)C(F)(F)F)=N\O)cc1 |
| InChI | InChI=1S/C20H17Cl2F3N2O3/c1-11(28)6-19(29)26-16-4-2-12(3-5-16)18(27-30)10-17(20(23,24)25)13-7-14(21)9-15(22)8-13/h2-5,7-11,28,30H,6H2,1H3,(H,26,29)/b17-10-,27-18- |
| InChIKey | VBURJEDKNRHMDW-GCQWMNBOSA-N |
| XLogP | 5.53 |
| TPSA | 81.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.27 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|