C10H5Cl2F3O — CID 154069384
3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enal (PubChem CID 154069384) has the molecular formula C10H5Cl2F3O and a molecular weight of 269.05 g/mol. Its IUPAC name is 3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enal.
| Compound Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enal |
|---|---|
| PubChem CID | 154069384 |
| Molecular Formula | C10H5Cl2F3O |
| Molecular Weight | 269.05 g/mol |
| Exact Mass | 267.97 |
| IUPAC Name | 3-(3,5-dichlorophenyl)-4,4,4-trifluorobut-2-enal |
| SMILES | O=CC=C(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/C10H5Cl2F3O/c11-7-3-6(4-8(12)5-7)9(1-2-16)10(13,14)15/h1-5H |
| InChIKey | YYWBYMRGUVCLNE-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.05 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|