C18H10Cl4F6 — CID 161498560
1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 161498560) has the molecular formula C18H10Cl4F6 and a molecular weight of 482.08 g/mol. Its IUPAC name is 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 161498560 |
| Molecular Formula | C18H10Cl4F6 |
| Molecular Weight | 482.08 g/mol |
| Exact Mass | 479.94 |
| IUPAC Name | 1,3-dichloro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)F.C=C(c1cc(Cl)cc(Cl)c1)C(F)(F)F |
| InChI | InChI=1S/2C9H5Cl2F3/c2*1-5(9(12,13)14)6-2-7(10)4-8(11)3-6/h2*2-4H,1H2 |
| InChIKey | WGNPMVWBQZUIKK-UHFFFAOYSA-N |
| XLogP | 9.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.08 |
| LogP ≤ 5 | 9.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |