C15H6Cl4F5I — CID 157121631
1,3-dichloro-2-fluoro-5-iodobenzene;1,3-dichloro-2-fluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene (PubChem CID 157121631) has the molecular formula C15H6Cl4F5I and a molecular weight of 549.92 g/mol. Its IUPAC name is 1,3-dichloro-2-fluoro-5-iodobenzene;1,3-dichloro-2-fluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene.
| Compound Name | 1,3-dichloro-2-fluoro-5-iodobenzene;1,3-dichloro-2-fluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
|---|---|
| PubChem CID | 157121631 |
| Molecular Formula | C15H6Cl4F5I |
| Molecular Weight | 549.92 g/mol |
| Exact Mass | 547.82 |
| IUPAC Name | 1,3-dichloro-2-fluoro-5-iodobenzene;1,3-dichloro-2-fluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene |
| SMILES | C=C(c1cc(Cl)c(F)c(Cl)c1)C(F)(F)F.Fc1c(Cl)cc(I)cc1Cl |
| InChI | InChI=1S/C9H4Cl2F4.C6H2Cl2FI/c1-4(9(13,14)15)5-2-6(10)8(12)7(11)3-5;7-4-1-3(10)2-5(8)6(4)9/h2-3H,1H2;1-2H |
| InChIKey | AIAQPCIIACFDOZ-UHFFFAOYSA-N |
| XLogP | 8.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.92 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|