C36H21Cl4F10OP — CID 158849851
1-(3,5-dichloro-2,4-difluorophenyl)-2,2,2-trifluoroethanone;1,3-dichloro-2,4-difluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene;methanidyl(triphenyl)phosphanium (PubChem CID 158849851) has the molecular formula C36H21Cl4F10OP and a molecular weight of 832.33 g/mol. Its IUPAC name is 1-(3,5-dichloro-2,4-difluorophenyl)-2,2,2-trifluoroethanone;1,3-dichloro-2,4-difluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene;methanidyl(triphenyl)phosphanium.
| Compound Name | 1-(3,5-dichloro-2,4-difluorophenyl)-2,2,2-trifluoroethanone;1,3-dichloro-2,4-difluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene;methanidyl(triphenyl)phosphanium |
|---|---|
| PubChem CID | 158849851 |
| Molecular Formula | C36H21Cl4F10OP |
| Molecular Weight | 832.33 g/mol |
| Exact Mass | 829.99 |
| IUPAC Name | 1-(3,5-dichloro-2,4-difluorophenyl)-2,2,2-trifluoroethanone;1,3-dichloro-2,4-difluoro-5-(3,3,3-trifluoroprop-1-en-2-yl)benzene;methanidyl(triphenyl)phosphanium |
| SMILES | C=C(c1cc(Cl)c(F)c(Cl)c1F)C(F)(F)F.O=C(c1cc(Cl)c(F)c(Cl)c1F)C(F)(F)F.[CH2-][P+](c1ccccc1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C19H17P.C9H3Cl2F5.C8HCl2F5O/c1-20(17-11-5-2-6-12-17,18-13-7-3-8-14-18)19-15-9-4-10-16-19;1-3(9(14,15)16)4-2-5(10)8(13)6(11)7(4)12;9-3-1-2(7(16)8(13,14)15)5(11)4(10)6(3)12/h2-16H,1H2;2H,1H2;1H |
| InChIKey | IZHQWGNTUGPVFE-UHFFFAOYSA-N |
| XLogP | 12.64 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.33 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|