C8H4Cl2F3NO — CID 175139481
1-(4-amino-2,3-dichlorophenyl)-2,2,2-trifluoroethanone (PubChem CID 175139481) has the molecular formula C8H4Cl2F3NO and a molecular weight of 258.03 g/mol. Its IUPAC name is 1-(4-amino-2,3-dichlorophenyl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(4-amino-2,3-dichlorophenyl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 175139481 |
| Molecular Formula | C8H4Cl2F3NO |
| Molecular Weight | 258.03 g/mol |
| Exact Mass | 256.96 |
| IUPAC Name | 1-(4-amino-2,3-dichlorophenyl)-2,2,2-trifluoroethanone |
| SMILES | Nc1ccc(C(=O)C(F)(F)F)c(Cl)c1Cl |
| InChI | InChI=1S/C8H4Cl2F3NO/c9-5-3(7(15)8(11,12)13)1-2-4(14)6(5)10/h1-2H,14H2 |
| InChIKey | FOURVSWKAMYYNT-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.03 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|