C9H9F3N2O — CID 174926902
1-[4-amino-3-(aminomethyl)phenyl]-2,2,2-trifluoroethanone (PubChem CID 174926902) has the molecular formula C9H9F3N2O and a molecular weight of 218.18 g/mol. Its IUPAC name is 1-[4-amino-3-(aminomethyl)phenyl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[4-amino-3-(aminomethyl)phenyl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 174926902 |
| Molecular Formula | C9H9F3N2O |
| Molecular Weight | 218.18 g/mol |
| Exact Mass | 218.07 |
| IUPAC Name | 1-[4-amino-3-(aminomethyl)phenyl]-2,2,2-trifluoroethanone |
| SMILES | NCc1cc(C(=O)C(F)(F)F)ccc1N |
| InChI | InChI=1S/C9H9F3N2O/c10-9(11,12)8(15)5-1-2-7(14)6(3-5)4-13/h1-3H,4,13-14H2 |
| InChIKey | FOXJYQXGIJKYPY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 69.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.18 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|