C12H11F3N2O — CID 82380642
1-[3-(2-aminoethyl)-1H-indol-5-yl]-2,2,2-trifluoroethanone (PubChem CID 82380642) has the molecular formula C12H11F3N2O and a molecular weight of 256.23 g/mol. Its IUPAC name is 1-[3-(2-aminoethyl)-1H-indol-5-yl]-2,2,2-trifluoroethanone.
| Compound Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 82380642 |
| Molecular Formula | C12H11F3N2O |
| Molecular Weight | 256.23 g/mol |
| Exact Mass | 256.08 |
| IUPAC Name | 1-[3-(2-aminoethyl)-1H-indol-5-yl]-2,2,2-trifluoroethanone |
| SMILES | NCCc1c[nH]c2ccc(C(=O)C(F)(F)F)cc12 |
| InChI | InChI=1S/C12H11F3N2O/c13-12(14,15)11(18)7-1-2-10-9(5-7)8(3-4-16)6-17-10/h1-2,5-6,17H,3-4,16H2 |
| InChIKey | GVDVGTXBJDCLRV-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.23 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |