C10H16N4O3S — CID 67549652
3-(2-aminoethyl)-1H-indol-5-ol;sulfamide (PubChem CID 67549652) has the molecular formula C10H16N4O3S and a molecular weight of 272.33 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;sulfamide.
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;sulfamide |
|---|---|
| PubChem CID | 67549652 |
| Molecular Formula | C10H16N4O3S |
| Molecular Weight | 272.33 g/mol |
| Exact Mass | 272.09 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;sulfamide |
| SMILES | NCCc1c[nH]c2ccc(O)cc12.NS(N)(=O)=O |
| InChI | InChI=1S/C10H12N2O.H4N2O2S/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-5(2,3)4/h1-2,5-6,12-13H,3-4,11H2;(H4,1,2,3,4) |
| InChIKey | GOKXZIURSNDYBO-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 148.22 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.33 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |