C19H25N3O4 — CID 67527789
3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol (PubChem CID 67527789) has the molecular formula C19H25N3O4 and a molecular weight of 359.43 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol.
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
|---|---|
| PubChem CID | 67527789 |
| Molecular Formula | C19H25N3O4 |
| Molecular Weight | 359.43 g/mol |
| Exact Mass | 359.18 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;4-[(1R)-1-hydroxy-2-(methylamino)ethyl]benzene-1,2-diol |
| SMILES | CNC[C@H](O)c1ccc(O)c(O)c1.NCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C10H12N2O.C9H13NO3/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;1-10-5-9(13)6-2-3-7(11)8(12)4-6/h1-2,5-6,12-13H,3-4,11H2;2-4,9-13H,5H2,1H3/t;9-/m.0/s1 |
| InChIKey | DZLVRWAFTDURGO-NPULLEENSA-N |
| XLogP | 1.73 |
| TPSA | 134.76 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.43 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|