C16H24N2O7 — CID 174747773
3-(2-aminoethyl)-1H-indol-5-ol;1,3,4,5,6-pentahydroxyhexan-2-one (PubChem CID 174747773) has the molecular formula C16H24N2O7 and a molecular weight of 356.38 g/mol. Its IUPAC name is 3-(2-aminoethyl)-1H-indol-5-ol;1,3,4,5,6-pentahydroxyhexan-2-one.
| Compound Name | 3-(2-aminoethyl)-1H-indol-5-ol;1,3,4,5,6-pentahydroxyhexan-2-one |
|---|---|
| PubChem CID | 174747773 |
| Molecular Formula | C16H24N2O7 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.16 |
| IUPAC Name | 3-(2-aminoethyl)-1H-indol-5-ol;1,3,4,5,6-pentahydroxyhexan-2-one |
| SMILES | NCCc1c[nH]c2ccc(O)cc12.O=C(CO)C(O)C(O)C(O)CO |
| InChI | InChI=1S/C10H12N2O.C6H12O6/c11-4-3-7-6-12-10-2-1-8(13)5-9(7)10;7-1-3(9)5(11)6(12)4(10)2-8/h1-2,5-6,12-13H,3-4,11H2;3,5-9,11-12H,1-2H2 |
| InChIKey | AFWQJUQNLITGJI-UHFFFAOYSA-N |
| XLogP | -2.00 |
| TPSA | 180.26 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | -2.00 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |