About 3-propyl-1H-indol-5-ol
3-propyl-1H-indol-5-ol (PubChem CID 15366338) has the molecular formula C11H13NO
and a molecular weight of 175.23 g/mol. Its IUPAC name is 3-propyl-1H-indol-5-ol.
Molecular Properties
| Compound Name | 3-propyl-1H-indol-5-ol |
| PubChem CID | 15366338 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | 3-propyl-1H-indol-5-ol |
| SMILES | CCCc1c[nH]c2ccc(O)cc12 |
| InChI | InChI=1S/C11H13NO/c1-2-3-8-7-12-11-5-4-9(13)6-10(8)11/h4-7,12-13H,2-3H2,1H3 |
| InChIKey | DLFDSJMYPRRFJP-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-propyl-1H-indol-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-propyl-1H-indol-5-ol?
The IUPAC name of 3-propyl-1H-indol-5-ol (CID 15366338) is 3-propyl-1H-indol-5-ol.
What is the SMILES notation for 3-propyl-1H-indol-5-ol?
The canonical SMILES for 3-propyl-1H-indol-5-ol is CCCc1c[nH]c2ccc(O)cc12.
What is the InChIKey of 3-propyl-1H-indol-5-ol?
The InChIKey is DLFDSJMYPRRFJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO/c1-2-3-8-7-12-11-5-4-9(13)6-10(8)11/h4-7,12-13H,2-3H2,1H3.
What are the key properties of 3-propyl-1H-indol-5-ol?
3-propyl-1H-indol-5-ol has a molecular weight of 175.23 g/mol, XLogP of 2.83, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-propyl-1H-indol-5-ol is sourced from PubChem (CID 15366338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).