C17H16N2O3 — CID 135581382
2-[2-(5-hydroxy-1H-indol-3-yl)ethyliminomethyl]benzene-1,3-diol (PubChem CID 135581382) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 2-[2-(5-hydroxy-1H-indol-3-yl)ethyliminomethyl]benzene-1,3-diol.
| Compound Name | 2-[2-(5-hydroxy-1H-indol-3-yl)ethyliminomethyl]benzene-1,3-diol |
|---|---|
| PubChem CID | 135581382 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 2-[2-(5-hydroxy-1H-indol-3-yl)ethyliminomethyl]benzene-1,3-diol |
| SMILES | Oc1ccc2[nH]cc(CC/N=C/c3c(O)cccc3O)c2c1 |
| InChI | InChI=1S/C17H16N2O3/c20-12-4-5-15-13(8-12)11(9-19-15)6-7-18-10-14-16(21)2-1-3-17(14)22/h1-5,8-10,19-22H,6-7H2/b18-10+ |
| InChIKey | VJTLUUXGIJYXHT-VCHYOVAHSA-N |
| XLogP | 2.95 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|