C19H22N4O2S — CID 4657988
1,3-diethyl-6-hydroxy-5-[2-(1H-indol-3-yl)ethyliminomethyl]-2-sulfanylidenepyrimidin-4-one (PubChem CID 4657988) has the molecular formula C19H22N4O2S and a molecular weight of 370.48 g/mol. Its IUPAC name is 1,3-diethyl-6-hydroxy-5-[2-(1H-indol-3-yl)ethyliminomethyl]-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1,3-diethyl-6-hydroxy-5-[2-(1H-indol-3-yl)ethyliminomethyl]-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 4657988 |
| Molecular Formula | C19H22N4O2S |
| Molecular Weight | 370.48 g/mol |
| Exact Mass | 370.15 |
| IUPAC Name | 1,3-diethyl-6-hydroxy-5-[2-(1H-indol-3-yl)ethyliminomethyl]-2-sulfanylidenepyrimidin-4-one |
| SMILES | CCn1c(O)c(/C=N/CCc2c[nH]c3ccccc23)c(=O)n(CC)c1=S |
| InChI | InChI=1S/C19H22N4O2S/c1-3-22-17(24)15(18(25)23(4-2)19(22)26)12-20-10-9-13-11-21-16-8-6-5-7-14(13)16/h5-8,11-12,21,24H,3-4,9-10H2,1-2H3/b20-12+ |
| InChIKey | ZKFBCMFIXFLYIU-UDWIEESQSA-N |
| XLogP | 3.27 |
| TPSA | 75.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.48 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|