C19H20N2 — CID 10826340
N-[2-(1H-indol-3-yl)ethyl]-3-phenylpropan-1-imine (PubChem CID 10826340) has the molecular formula C19H20N2 and a molecular weight of 276.38 g/mol. Its IUPAC name is N-[2-(1H-indol-3-yl)ethyl]-3-phenylpropan-1-imine.
| Compound Name | N-[2-(1H-indol-3-yl)ethyl]-3-phenylpropan-1-imine |
|---|---|
| PubChem CID | 10826340 |
| Molecular Formula | C19H20N2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.16 |
| IUPAC Name | N-[2-(1H-indol-3-yl)ethyl]-3-phenylpropan-1-imine |
| SMILES | C(\CCc1ccccc1)=N/CCc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C19H20N2/c1-2-7-16(8-3-1)9-6-13-20-14-12-17-15-21-19-11-5-4-10-18(17)19/h1-5,7-8,10-11,13,15,21H,6,9,12,14H2/b20-13+ |
| InChIKey | MDYWZHSYWXTVGZ-DEDYPNTBSA-N |
| XLogP | 4.41 |
| TPSA | 28.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|