C25H26N4O3 — CID 136815832
6-hydroxy-5-[[(2S)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-(2-phenylethyl)pyrimidine-2,4-dione (PubChem CID 136815832) has the molecular formula C25H26N4O3 and a molecular weight of 430.51 g/mol. Its IUPAC name is 6-hydroxy-5-[[(2S)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-(2-phenylethyl)pyrimidine-2,4-dione.
| Compound Name | 6-hydroxy-5-[[(2S)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-(2-phenylethyl)pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 136815832 |
| Molecular Formula | C25H26N4O3 |
| Molecular Weight | 430.51 g/mol |
| Exact Mass | 430.20 |
| IUPAC Name | 6-hydroxy-5-[[(2S)-1-(1H-indol-3-yl)butan-2-yl]iminomethyl]-1-(2-phenylethyl)pyrimidine-2,4-dione |
| SMILES | CC[C@@H](Cc1c[nH]c2ccccc12)/N=C/c1c(O)n(CCc2ccccc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C25H26N4O3/c1-2-19(14-18-15-27-22-11-7-6-10-20(18)22)26-16-21-23(30)28-25(32)29(24(21)31)13-12-17-8-4-3-5-9-17/h3-11,15-16,19,27,31H,2,12-14H2,1H3,(H,28,30,32)/b26-16+/t19-/m0/s1 |
| InChIKey | RWEHTFANKGRNTP-JHKMYFMNSA-N |
| XLogP | 3.41 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.51 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|