C25H24N4O6 — CID 3524524
methyl 2-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoate (PubChem CID 3524524) has the molecular formula C25H24N4O6 and a molecular weight of 476.49 g/mol. Its IUPAC name is methyl 2-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoate.
| Compound Name | methyl 2-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoate |
|---|---|
| PubChem CID | 3524524 |
| Molecular Formula | C25H24N4O6 |
| Molecular Weight | 476.49 g/mol |
| Exact Mass | 476.17 |
| IUPAC Name | methyl 2-[[1-(4-ethoxyphenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]-3-(1H-indol-3-yl)propanoate |
| SMILES | CCOc1ccc(-n2c(O)c(/C=N/C(Cc3c[nH]c4ccccc34)C(=O)OC)c(=O)[nH]c2=O)cc1 |
| InChI | InChI=1S/C25H24N4O6/c1-3-35-17-10-8-16(9-11-17)29-23(31)19(22(30)28-25(29)33)14-27-21(24(32)34-2)12-15-13-26-20-7-5-4-6-18(15)20/h4-11,13-14,21,26,31H,3,12H2,1-2H3,(H,28,30,33)/b27-14+ |
| InChIKey | HOUHGXZKNLCJQH-MZJWZYIUSA-N |
| XLogP | 2.31 |
| TPSA | 138.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.49 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|