C23H21ClN4O3 — CID 3697230
1-(4-chlorophenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione (PubChem CID 3697230) has the molecular formula C23H21ClN4O3 and a molecular weight of 436.90 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-chlorophenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 3697230 |
| Molecular Formula | C23H21ClN4O3 |
| Molecular Weight | 436.90 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | 1-(4-chlorophenyl)-6-hydroxy-5-[1-(1H-indol-3-yl)butan-2-yliminomethyl]pyrimidine-2,4-dione |
| SMILES | CCC(Cc1c[nH]c2ccccc12)/N=C/c1c(O)n(-c2ccc(Cl)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C23H21ClN4O3/c1-2-16(11-14-12-26-20-6-4-3-5-18(14)20)25-13-19-21(29)27-23(31)28(22(19)30)17-9-7-15(24)8-10-17/h3-10,12-13,16,26,30H,2,11H2,1H3,(H,27,29,31)/b25-13+ |
| InChIKey | ZCIIYCITAPQBHU-DHRITJCHSA-N |
| XLogP | 3.81 |
| TPSA | 103.24 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.90 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|