C19H24FN3O3 — CID 135974368
1-(4-fluorophenyl)-6-hydroxy-5-[[(2R)-octan-2-yl]iminomethyl]pyrimidine-2,4-dione (PubChem CID 135974368) has the molecular formula C19H24FN3O3 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-6-hydroxy-5-[[(2R)-octan-2-yl]iminomethyl]pyrimidine-2,4-dione.
| Compound Name | 1-(4-fluorophenyl)-6-hydroxy-5-[[(2R)-octan-2-yl]iminomethyl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135974368 |
| Molecular Formula | C19H24FN3O3 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 1-(4-fluorophenyl)-6-hydroxy-5-[[(2R)-octan-2-yl]iminomethyl]pyrimidine-2,4-dione |
| SMILES | CCCCCC[C@@H](C)/N=C/c1c(O)n(-c2ccc(F)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C19H24FN3O3/c1-3-4-5-6-7-13(2)21-12-16-17(24)22-19(26)23(18(16)25)15-10-8-14(20)9-11-15/h8-13,25H,3-7H2,1-2H3,(H,22,24,26)/b21-12+/t13-/m1/s1 |
| InChIKey | CHNNGGCWQITAEN-LNOXHEFASA-N |
| XLogP | 3.15 |
| TPSA | 87.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|