C20H27BrN4O3 — CID 135885521
1-(4-bromophenyl)-5-[[(2S)-5-(diethylamino)pentan-2-yl]iminomethyl]-6-hydroxypyrimidine-2,4-dione (PubChem CID 135885521) has the molecular formula C20H27BrN4O3 and a molecular weight of 451.37 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-[[(2S)-5-(diethylamino)pentan-2-yl]iminomethyl]-6-hydroxypyrimidine-2,4-dione.
| Compound Name | 1-(4-bromophenyl)-5-[[(2S)-5-(diethylamino)pentan-2-yl]iminomethyl]-6-hydroxypyrimidine-2,4-dione |
|---|---|
| PubChem CID | 135885521 |
| Molecular Formula | C20H27BrN4O3 |
| Molecular Weight | 451.37 g/mol |
| Exact Mass | 450.13 |
| IUPAC Name | 1-(4-bromophenyl)-5-[[(2S)-5-(diethylamino)pentan-2-yl]iminomethyl]-6-hydroxypyrimidine-2,4-dione |
| SMILES | CCN(CC)CCC[C@H](C)/N=C/c1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C20H27BrN4O3/c1-4-24(5-2)12-6-7-14(3)22-13-17-18(26)23-20(28)25(19(17)27)16-10-8-15(21)9-11-16/h8-11,13-14,27H,4-7,12H2,1-3H3,(H,23,26,28)/b22-13+/t14-/m0/s1 |
| InChIKey | KNRXFSHSQJCZSA-KOUDTOEKSA-N |
| XLogP | 2.92 |
| TPSA | 90.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.37 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|