C12H11BrN6O3 — CID 135632095
2-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]guanidine (PubChem CID 135632095) has the molecular formula C12H11BrN6O3 and a molecular weight of 367.16 g/mol. Its IUPAC name is 2-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]guanidine.
| Compound Name | 2-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]guanidine |
|---|---|
| PubChem CID | 135632095 |
| Molecular Formula | C12H11BrN6O3 |
| Molecular Weight | 367.16 g/mol |
| Exact Mass | 366.01 |
| IUPAC Name | 2-[(E)-[1-(4-bromophenyl)-6-hydroxy-2,4-dioxopyrimidin-5-yl]methylideneamino]guanidine |
| SMILES | NC(N)=N/N=C/c1c(O)n(-c2ccc(Br)cc2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C12H11BrN6O3/c13-6-1-3-7(4-2-6)19-10(21)8(5-16-18-11(14)15)9(20)17-12(19)22/h1-5,21H,(H4,14,15,18)(H,17,20,22)/b16-5+ |
| InChIKey | PTPIHTOFTHIEOR-FZSIALSZSA-N |
| XLogP | -0.40 |
| TPSA | 151.85 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.16 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|